C13H10Cl2N4O — CID 154954876
5-(5,6-dichloro-3-pyridinyl)-3-ethyl-7H-pyrrolo[2,3-d]pyrimidin-4-one (PubChem CID 154954876) has the molecular formula C13H10Cl2N4O and a molecular weight of 309.16 g/mol. Its IUPAC name is 5-(5,6-dichloro-3-pyridinyl)-3-ethyl-7H-pyrrolo[2,3-d]pyrimidin-4-one.
| Compound Name | 5-(5,6-dichloro-3-pyridinyl)-3-ethyl-7H-pyrrolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 154954876 |
| Molecular Formula | C13H10Cl2N4O |
| Molecular Weight | 309.16 g/mol |
| Exact Mass | 308.02 |
| IUPAC Name | 5-(5,6-dichloro-3-pyridinyl)-3-ethyl-7H-pyrrolo[2,3-d]pyrimidin-4-one |
| SMILES | CCn1cnc2[nH]cc(-c3cnc(Cl)c(Cl)c3)c2c1=O |
| InChI | InChI=1S/C13H10Cl2N4O/c1-2-19-6-18-12-10(13(19)20)8(5-17-12)7-3-9(14)11(15)16-4-7/h3-6,17H,2H2,1H3 |
| InChIKey | XLKTVWKCFIDICI-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.16 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|