C69H41N5S2 — CID 154954936
2-[3-dibenzothiophen-1-yl-5-[4-[4-(4-dibenzothiophen-1-yl-6-phenyl-1,3,5-triazin-2-yl)phenyl]phenyl]phenyl]-9-phenyl-1,10-phenanthroline (PubChem CID 154954936) has the molecular formula C69H41N5S2 and a molecular weight of 1004.26 g/mol. Its IUPAC name is 2-[3-dibenzothiophen-1-yl-5-[4-[4-(4-dibenzothiophen-1-yl-6-phenyl-1,3,5-triazin-2-yl)phenyl]phenyl]phenyl]-9-phenyl-1,10-phenanthroline.
| Compound Name | 2-[3-dibenzothiophen-1-yl-5-[4-[4-(4-dibenzothiophen-1-yl-6-phenyl-1,3,5-triazin-2-yl)phenyl]phenyl]phenyl]-9-phenyl-1,10-phenanthroline |
|---|---|
| PubChem CID | 154954936 |
| Molecular Formula | C69H41N5S2 |
| Molecular Weight | 1004.26 g/mol |
| Exact Mass | 1003.28 |
| IUPAC Name | 2-[3-dibenzothiophen-1-yl-5-[4-[4-(4-dibenzothiophen-1-yl-6-phenyl-1,3,5-triazin-2-yl)phenyl]phenyl]phenyl]-9-phenyl-1,10-phenanthroline |
| SMILES | c1ccc(-c2ccc3ccc4ccc(-c5cc(-c6ccc(-c7ccc(-c8nc(-c9ccccc9)nc(-c9cccc%10sc%11ccccc%11c9%10)n8)cc7)cc6)cc(-c6cccc7sc8ccccc8c67)c5)nc4c3n2)cc1 |
| InChI | InChI=1S/C69H41N5S2/c1-3-13-45(14-4-1)57-37-35-46-31-32-47-36-38-58(71-66(47)65(46)70-57)52-40-50(39-51(41-52)53-19-11-23-61-63(53)54-17-7-9-21-59(54)75-61)44-27-25-42(26-28-44)43-29-33-49(34-30-43)68-72-67(48-15-5-2-6-16-48)73-69(74-68)56-20-12-24-62-64(56)55-18-8-10-22-60(55)76-62/h1-41H |
| InChIKey | VGHGCWZRUMOZFA-UHFFFAOYSA-N |
| XLogP | 19.04 |
| TPSA | 64.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 76 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1004.26 |
| LogP ≤ 5 | 19.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|