C75H65NO — CID 154955026
2,7-ditert-butyl-9-(4-dibenzofuran-4-ylphenyl)-N,N-bis(9,9-dimethylfluoren-2-yl)-9-phenylfluoren-4-amine (PubChem CID 154955026) has the molecular formula C75H65NO and a molecular weight of 996.35 g/mol. Its IUPAC name is 2,7-ditert-butyl-9-(4-dibenzofuran-4-ylphenyl)-N,N-bis(9,9-dimethylfluoren-2-yl)-9-phenylfluoren-4-amine.
| Compound Name | 2,7-ditert-butyl-9-(4-dibenzofuran-4-ylphenyl)-N,N-bis(9,9-dimethylfluoren-2-yl)-9-phenylfluoren-4-amine |
|---|---|
| PubChem CID | 154955026 |
| Molecular Formula | C75H65NO |
| Molecular Weight | 996.35 g/mol |
| Exact Mass | 995.51 |
| IUPAC Name | 2,7-ditert-butyl-9-(4-dibenzofuran-4-ylphenyl)-N,N-bis(9,9-dimethylfluoren-2-yl)-9-phenylfluoren-4-amine |
| SMILES | CC(C)(C)c1ccc2c(c1)C(c1ccccc1)(c1ccc(-c3cccc4c3oc3ccccc34)cc1)c1cc(C(C)(C)C)cc(N(c3ccc4c(c3)C(C)(C)c3ccccc3-4)c3ccc4c(c3)C(C)(C)c3ccccc3-4)c1-2 |
| InChI | InChI=1S/C75H65NO/c1-71(2,3)49-35-38-60-65(41-49)75(47-21-12-11-13-22-47,48-33-31-46(32-34-48)53-26-20-27-59-58-25-16-19-30-68(58)77-70(53)59)66-42-50(72(4,5)6)43-67(69(60)66)76(51-36-39-56-54-23-14-17-28-61(54)73(7,8)63(56)44-51)52-37-40-57-55-24-15-18-29-62(55)74(9,10)64(57)45-52/h11-45H,1-10H3 |
| InChIKey | TWYYGFGGCYFTLH-UHFFFAOYSA-N |
| XLogP | 20.29 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 77 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 996.35 |
| LogP ≤ 5 | 20.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |