C17H29NO3 — CID 154955461
N-[(3E)-5-hydroxy-4-methoxy-2-methylidenehexa-3,5-dienyl]nonanamide (PubChem CID 154955461) has the molecular formula C17H29NO3 and a molecular weight of 295.42 g/mol. Its IUPAC name is N-[(3E)-5-hydroxy-4-methoxy-2-methylidenehexa-3,5-dienyl]nonanamide.
| Compound Name | N-[(3E)-5-hydroxy-4-methoxy-2-methylidenehexa-3,5-dienyl]nonanamide |
|---|---|
| PubChem CID | 154955461 |
| Molecular Formula | C17H29NO3 |
| Molecular Weight | 295.42 g/mol |
| Exact Mass | 295.21 |
| IUPAC Name | N-[(3E)-5-hydroxy-4-methoxy-2-methylidenehexa-3,5-dienyl]nonanamide |
| SMILES | C=C(/C=C(/OC)C(=C)O)CNC(=O)CCCCCCCC |
| InChI | InChI=1S/C17H29NO3/c1-5-6-7-8-9-10-11-17(20)18-13-14(2)12-16(21-4)15(3)19/h12,19H,2-3,5-11,13H2,1,4H3,(H,18,20)/b16-12+ |
| InChIKey | QKJBDCAGADQHLI-FOWTUZBSSA-N |
| XLogP | 4.01 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.42 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|