C28H52N2 — CID 154955508
(E,1E)-N,2,2,5,5-pentamethyl-1-(1-methylazonan-2-ylidene)tetradec-3-en-6-imine (PubChem CID 154955508) has the molecular formula C28H52N2 and a molecular weight of 416.74 g/mol. Its IUPAC name is (E,1E)-N,2,2,5,5-pentamethyl-1-(1-methylazonan-2-ylidene)tetradec-3-en-6-imine.
| Compound Name | (E,1E)-N,2,2,5,5-pentamethyl-1-(1-methylazonan-2-ylidene)tetradec-3-en-6-imine |
|---|---|
| PubChem CID | 154955508 |
| Molecular Formula | C28H52N2 |
| Molecular Weight | 416.74 g/mol |
| Exact Mass | 416.41 |
| IUPAC Name | (E,1E)-N,2,2,5,5-pentamethyl-1-(1-methylazonan-2-ylidene)tetradec-3-en-6-imine |
| SMILES | CCCCCCCC/C(=N\C)C(C)(C)/C=C/C(C)(C)/C=C1\CCCCCCCN1C |
| InChI | InChI=1S/C28H52N2/c1-8-9-10-11-14-17-20-26(29-6)28(4,5)22-21-27(2,3)24-25-19-16-13-12-15-18-23-30(25)7/h21-22,24H,8-20,23H2,1-7H3/b22-21+,25-24+,29-26+ |
| InChIKey | LNWROMGXTOAEOP-WHAGLBLHSA-N |
| XLogP | 8.59 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.74 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|