C21H39N2+ — CID 154955614
(1E,4E)-N,N,3,3,6-pentamethyl-6-(1-methyl-3,4,5,6,7,8-hexahydro-2H-azonin-1-ium-9-yl)hepta-1,4-dien-1-amine (PubChem CID 154955614) has the molecular formula C21H39N2+ and a molecular weight of 319.56 g/mol. Its IUPAC name is (1E,4E)-N,N,3,3,6-pentamethyl-6-(1-methyl-3,4,5,6,7,8-hexahydro-2H-azonin-1-ium-9-yl)hepta-1,4-dien-1-amine.
| Compound Name | (1E,4E)-N,N,3,3,6-pentamethyl-6-(1-methyl-3,4,5,6,7,8-hexahydro-2H-azonin-1-ium-9-yl)hepta-1,4-dien-1-amine |
|---|---|
| PubChem CID | 154955614 |
| Molecular Formula | C21H39N2+ |
| Molecular Weight | 319.56 g/mol |
| Exact Mass | 319.31 |
| IUPAC Name | (1E,4E)-N,N,3,3,6-pentamethyl-6-(1-methyl-3,4,5,6,7,8-hexahydro-2H-azonin-1-ium-9-yl)hepta-1,4-dien-1-amine |
| SMILES | CN(C)/C=C/C(C)(C)/C=C/C(C)(C)/C1=[N+](\C)CCCCCCC1 |
| InChI | InChI=1S/C21H39N2/c1-20(2,16-18-22(5)6)14-15-21(3,4)19-13-11-9-8-10-12-17-23(19)7/h14-16,18H,8-13,17H2,1-7H3/q+1/b15-14+,18-16+,23-19+ |
| InChIKey | IQKAKKQYQXEAEQ-LXVCUWKXSA-N |
| XLogP | 5.11 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.56 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|