C25H36N4O9S — CID 154956317
[(E)-1-[(4R)-4-amino-4-[[(1R)-1-(6-oxo-4-prop-2-enoxypyran-2-yl)butyl]carbamoyl]-5H-1,3-thiazol-2-yl]ethylideneamino] 2-[2-(2-methoxyethoxy)ethoxy]acetate (PubChem CID 154956317) has the molecular formula C25H36N4O9S and a molecular weight of 568.65 g/mol. Its IUPAC name is [(E)-1-[(4R)-4-amino-4-[[(1R)-1-(6-oxo-4-prop-2-enoxypyran-2-yl)butyl]carbamoyl]-5H-1,3-thiazol-2-yl]ethylideneamino] 2-[2-(2-methoxyethoxy)ethoxy]acetate.
| Compound Name | [(E)-1-[(4R)-4-amino-4-[[(1R)-1-(6-oxo-4-prop-2-enoxypyran-2-yl)butyl]carbamoyl]-5H-1,3-thiazol-2-yl]ethylideneamino] 2-[2-(2-methoxyethoxy)ethoxy]acetate |
|---|---|
| PubChem CID | 154956317 |
| Molecular Formula | C25H36N4O9S |
| Molecular Weight | 568.65 g/mol |
| Exact Mass | 568.22 |
| IUPAC Name | [(E)-1-[(4R)-4-amino-4-[[(1R)-1-(6-oxo-4-prop-2-enoxypyran-2-yl)butyl]carbamoyl]-5H-1,3-thiazol-2-yl]ethylideneamino] 2-[2-(2-methoxyethoxy)ethoxy]acetate |
| SMILES | C=CCOc1cc([C@@H](CCC)NC(=O)[C@]2(N)CSC(/C(C)=N/OC(=O)COCCOCCOC)=N2)oc(=O)c1 |
| InChI | InChI=1S/C25H36N4O9S/c1-5-7-19(20-13-18(36-8-6-2)14-21(30)37-20)27-24(32)25(26)16-39-23(28-25)17(3)29-38-22(31)15-35-12-11-34-10-9-33-4/h6,13-14,19H,2,5,7-12,15-16,26H2,1,3-4H3,(H,27,32)/b29-17+/t19-,25+/m1/s1 |
| InChIKey | QZDBFOPODFBEQR-ZBSXBUOXSA-N |
| XLogP | 1.56 |
| TPSA | 173.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.65 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|