C24H37N3O8S — CID 154956422
(4R)-N-[(1R)-1-[4-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]-6-oxopyran-2-yl]butyl]-2-[(E)-N-hydroxy-C-methylcarbonimidoyl]-4-methyl-5H-1,3-thiazole-4-carboxamide (PubChem CID 154956422) has the molecular formula C24H37N3O8S and a molecular weight of 527.64 g/mol. Its IUPAC name is (4R)-N-[(1R)-1-[4-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]-6-oxopyran-2-yl]butyl]-2-[(E)-N-hydroxy-C-methylcarbonimidoyl]-4-methyl-5H-1,3-thiazole-4-carboxamide.
| Compound Name | (4R)-N-[(1R)-1-[4-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]-6-oxopyran-2-yl]butyl]-2-[(E)-N-hydroxy-C-methylcarbonimidoyl]-4-methyl-5H-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 154956422 |
| Molecular Formula | C24H37N3O8S |
| Molecular Weight | 527.64 g/mol |
| Exact Mass | 527.23 |
| IUPAC Name | (4R)-N-[(1R)-1-[4-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]-6-oxopyran-2-yl]butyl]-2-[(E)-N-hydroxy-C-methylcarbonimidoyl]-4-methyl-5H-1,3-thiazole-4-carboxamide |
| SMILES | CCC[C@@H](NC(=O)[C@]1(C)CSC(/C(C)=N/O)=N1)c1cc(OCCOCCOCCOCC)cc(=O)o1 |
| InChI | InChI=1S/C24H37N3O8S/c1-5-7-19(25-23(29)24(4)16-36-22(26-24)17(3)27-30)20-14-18(15-21(28)35-20)34-13-12-33-11-10-32-9-8-31-6-2/h14-15,19,30H,5-13,16H2,1-4H3,(H,25,29)/b27-17+/t19-,24+/m1/s1 |
| InChIKey | NSCNZPXDFTWTQR-WRWMUQEYSA-N |
| XLogP | 2.80 |
| TPSA | 141.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.64 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|