C45H53N3 — CID 154956466
9,9,21,21,33,33-hexamethyl-2,14,26-triazadecacyclo[24.10.2.210,13.222,25.02,11.03,8.014,23.015,20.027,32.034,38]dotetraconta-1(37),5,10,15,17,22,27,31,35,39,41-undecaene (PubChem CID 154956466) has the molecular formula C45H53N3 and a molecular weight of 635.94 g/mol. Its IUPAC name is 9,9,21,21,33,33-hexamethyl-2,14,26-triazadecacyclo[24.10.2.210,13.222,25.02,11.03,8.014,23.015,20.027,32.034,38]dotetraconta-1(37),5,10,15,17,22,27,31,35,39,41-undecaene.
| Compound Name | 9,9,21,21,33,33-hexamethyl-2,14,26-triazadecacyclo[24.10.2.210,13.222,25.02,11.03,8.014,23.015,20.027,32.034,38]dotetraconta-1(37),5,10,15,17,22,27,31,35,39,41-undecaene |
|---|---|
| PubChem CID | 154956466 |
| Molecular Formula | C45H53N3 |
| Molecular Weight | 635.94 g/mol |
| Exact Mass | 635.42 |
| IUPAC Name | 9,9,21,21,33,33-hexamethyl-2,14,26-triazadecacyclo[24.10.2.210,13.222,25.02,11.03,8.014,23.015,20.027,32.034,38]dotetraconta-1(37),5,10,15,17,22,27,31,35,39,41-undecaene |
| SMILES | CC1(C)C2=C3CC(C=C2)N2C4=CCCC=C4C(C)(C)C4C=CC(=CC42)N2C4=C(C=CC(C4)N3C3=CC=CCC31)C(C)(C)C1CC=CCC12 |
| InChI | InChI=1S/C45H53N3/c1-43(2)31-13-7-10-16-37(31)46-29-20-23-35-41(26-29)48(39-18-12-9-15-33(39)45(35,5)6)30-21-24-36-42(27-30)47(28-19-22-34(43)40(46)25-28)38-17-11-8-14-32(38)44(36,3)4/h7-8,10-11,15,17-24,26,28,30-32,35,37,41H,9,12-14,16,25,27H2,1-6H3 |
| InChIKey | QIRPWZKXAGTFNI-UHFFFAOYSA-N |
| XLogP | 10.03 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.94 |
| LogP ≤ 5 | 10.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|