C22H22ClFN6 — CID 154956575
2-(5-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)-5-fluoro-N-[(2S,3S)-3-methyl-2-bicyclo[2.2.2]octanyl]pyrrolo[2,1-f][1,2,4]triazin-4-amine (PubChem CID 154956575) has the molecular formula C22H22ClFN6 and a molecular weight of 424.91 g/mol. Its IUPAC name is 2-(5-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)-5-fluoro-N-[(2S,3S)-3-methyl-2-bicyclo[2.2.2]octanyl]pyrrolo[2,1-f][1,2,4]triazin-4-amine.
| Compound Name | 2-(5-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)-5-fluoro-N-[(2S,3S)-3-methyl-2-bicyclo[2.2.2]octanyl]pyrrolo[2,1-f][1,2,4]triazin-4-amine |
|---|---|
| PubChem CID | 154956575 |
| Molecular Formula | C22H22ClFN6 |
| Molecular Weight | 424.91 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | 2-(5-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)-5-fluoro-N-[(2S,3S)-3-methyl-2-bicyclo[2.2.2]octanyl]pyrrolo[2,1-f][1,2,4]triazin-4-amine |
| SMILES | C[C@H]1C2CCC(CC2)[C@@H]1Nc1nc(-c2c[nH]c3ncc(Cl)cc23)nn2ccc(F)c12 |
| InChI | InChI=1S/C22H22ClFN6/c1-11-12-2-4-13(5-3-12)18(11)27-22-19-17(24)6-7-30(19)29-21(28-22)16-10-26-20-15(16)8-14(23)9-25-20/h6-13,18H,2-5H2,1H3,(H,25,26)(H,27,28,29)/t11-,12?,13?,18+/m0/s1 |
| InChIKey | HDEBEXMMRFOWDY-BRHYBRFTSA-N |
| XLogP | 5.30 |
| TPSA | 70.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.91 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |