C19H30N4O5S — CID 154956634
(4R)-N-[(1R)-1-[4-(3-aminopropoxy)-2-hydroxy-2H-pyran-6-yl]butyl]-2-[(E)-N-hydroxy-C-methylcarbonimidoyl]-4-methyl-5H-1,3-thiazole-4-carboxamide (PubChem CID 154956634) has the molecular formula C19H30N4O5S and a molecular weight of 426.54 g/mol. Its IUPAC name is (4R)-N-[(1R)-1-[4-(3-aminopropoxy)-2-hydroxy-2H-pyran-6-yl]butyl]-2-[(E)-N-hydroxy-C-methylcarbonimidoyl]-4-methyl-5H-1,3-thiazole-4-carboxamide.
| Compound Name | (4R)-N-[(1R)-1-[4-(3-aminopropoxy)-2-hydroxy-2H-pyran-6-yl]butyl]-2-[(E)-N-hydroxy-C-methylcarbonimidoyl]-4-methyl-5H-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 154956634 |
| Molecular Formula | C19H30N4O5S |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | (4R)-N-[(1R)-1-[4-(3-aminopropoxy)-2-hydroxy-2H-pyran-6-yl]butyl]-2-[(E)-N-hydroxy-C-methylcarbonimidoyl]-4-methyl-5H-1,3-thiazole-4-carboxamide |
| SMILES | CCC[C@@H](NC(=O)[C@]1(C)CSC(/C(C)=N/O)=N1)C1=CC(OCCCN)=CC(O)O1 |
| InChI | InChI=1S/C19H30N4O5S/c1-4-6-14(15-9-13(10-16(24)28-15)27-8-5-7-20)21-18(25)19(3)11-29-17(22-19)12(2)23-26/h9-10,14,16,24,26H,4-8,11,20H2,1-3H3,(H,21,25)/b23-12+/t14-,16?,19+/m1/s1 |
| InChIKey | NVEUWEZQKGPTHQ-GPWDUFRUSA-N |
| XLogP | 1.51 |
| TPSA | 138.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|