C32H31ClF3N3O4S — CID 154957190
2-amino-3-[4-[4-[(1R)-1-[4-chloro-2-(2,2,6,6-tetramethyl-3H-pyran-4-yl)phenyl]-2,2,2-trifluoroethoxy]thieno[3,2-d]pyrimidin-7-yl]phenyl]propanoic acid (PubChem CID 154957190) has the molecular formula C32H31ClF3N3O4S and a molecular weight of 646.13 g/mol. Its IUPAC name is 2-amino-3-[4-[4-[(1R)-1-[4-chloro-2-(2,2,6,6-tetramethyl-3H-pyran-4-yl)phenyl]-2,2,2-trifluoroethoxy]thieno[3,2-d]pyrimidin-7-yl]phenyl]propanoic acid.
| Compound Name | 2-amino-3-[4-[4-[(1R)-1-[4-chloro-2-(2,2,6,6-tetramethyl-3H-pyran-4-yl)phenyl]-2,2,2-trifluoroethoxy]thieno[3,2-d]pyrimidin-7-yl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 154957190 |
| Molecular Formula | C32H31ClF3N3O4S |
| Molecular Weight | 646.13 g/mol |
| Exact Mass | 645.17 |
| IUPAC Name | 2-amino-3-[4-[4-[(1R)-1-[4-chloro-2-(2,2,6,6-tetramethyl-3H-pyran-4-yl)phenyl]-2,2,2-trifluoroethoxy]thieno[3,2-d]pyrimidin-7-yl]phenyl]propanoic acid |
| SMILES | CC1(C)C=C(c2cc(Cl)ccc2[C@@H](Oc2ncnc3c(-c4ccc(CC(N)C(=O)O)cc4)csc23)C(F)(F)F)CC(C)(C)O1 |
| InChI | InChI=1S/C32H31ClF3N3O4S/c1-30(2)13-19(14-31(3,4)43-30)22-12-20(33)9-10-21(22)27(32(34,35)36)42-28-26-25(38-16-39-28)23(15-44-26)18-7-5-17(6-8-18)11-24(37)29(40)41/h5-10,12-13,15-16,24,27H,11,14,37H2,1-4H3,(H,40,41)/t24?,27-/m1/s1 |
| InChIKey | AFVBCHROHOVLGM-LFHRXCRSSA-N |
| XLogP | 8.01 |
| TPSA | 107.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.13 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |