About 2-(6-bromoimidazo[1,2-a]pyridin-3-yl)-N-[(2-methylpropan-2-yl)oxymethyl]ethanamine
2-(6-bromoimidazo[1,2-a]pyridin-3-yl)-N-[(2-methylpropan-2-yl)oxymethyl]ethanamine (PubChem CID 154958995) has the molecular formula C14H20BrN3O
and a molecular weight of 326.24 g/mol. Its IUPAC name is 2-(6-bromoimidazo[1,2-a]pyridin-3-yl)-N-[(2-methylpropan-2-yl)oxymethyl]ethanamine.
Molecular Properties
| Compound Name | 2-(6-bromoimidazo[1,2-a]pyridin-3-yl)-N-[(2-methylpropan-2-yl)oxymethyl]ethanamine |
| PubChem CID | 154958995 |
| Molecular Formula | C14H20BrN3O |
| Molecular Weight | 326.24 g/mol |
| Exact Mass | 325.08 |
| IUPAC Name | 2-(6-bromoimidazo[1,2-a]pyridin-3-yl)-N-[(2-methylpropan-2-yl)oxymethyl]ethanamine |
| SMILES | CC(C)(C)OCNCCc1cnc2ccc(Br)cn12 |
| InChI | InChI=1S/C14H20BrN3O/c1-14(2,3)19-10-16-7-6-12-8-17-13-5-4-11(15)9-18(12)13/h4-5,8-9,16H,6-7,10H2,1-3H3 |
| InChIKey | SHNGKMHFESVLEG-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 38.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.24 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-(6-bromoimidazo[1,2-a]pyridin-3-yl)-N-[(2-methylpropan-2-yl)oxymethyl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-bromoimidazo[1,2-a]pyridin-3-yl)-N-[(2-methylpropan-2-yl)oxymethyl]ethanamine?
The IUPAC name of 2-(6-bromoimidazo[1,2-a]pyridin-3-yl)-N-[(2-methylpropan-2-yl)oxymethyl]ethanamine (CID 154958995) is 2-(6-bromoimidazo[1,2-a]pyridin-3-yl)-N-[(2-methylpropan-2-yl)oxymethyl]ethanamine.
What is the SMILES notation for 2-(6-bromoimidazo[1,2-a]pyridin-3-yl)-N-[(2-methylpropan-2-yl)oxymethyl]ethanamine?
The canonical SMILES for 2-(6-bromoimidazo[1,2-a]pyridin-3-yl)-N-[(2-methylpropan-2-yl)oxymethyl]ethanamine is CC(C)(C)OCNCCc1cnc2ccc(Br)cn12.
What is the InChIKey of 2-(6-bromoimidazo[1,2-a]pyridin-3-yl)-N-[(2-methylpropan-2-yl)oxymethyl]ethanamine?
The InChIKey is SHNGKMHFESVLEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20BrN3O/c1-14(2,3)19-10-16-7-6-12-8-17-13-5-4-11(15)9-18(12)13/h4-5,8-9,16H,6-7,10H2,1-3H3.
What are the key properties of 2-(6-bromoimidazo[1,2-a]pyridin-3-yl)-N-[(2-methylpropan-2-yl)oxymethyl]ethanamine?
2-(6-bromoimidazo[1,2-a]pyridin-3-yl)-N-[(2-methylpropan-2-yl)oxymethyl]ethanamine has a molecular weight of 326.24 g/mol, XLogP of 3.00, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-bromoimidazo[1,2-a]pyridin-3-yl)-N-[(2-methylpropan-2-yl)oxymethyl]ethanamine is sourced from PubChem (CID 154958995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).