C24H32F2N8O2S — CID 154959661
4-(6-azaspiro[2.5]octan-6-yl)-N-[2-(4,4-difluoropiperidin-1-yl)-6-methylpyrimidin-4-yl]-2-(2-hydroxyethylsulfanylamino)pyrimidine-5-carboxamide (PubChem CID 154959661) has the molecular formula C24H32F2N8O2S and a molecular weight of 534.64 g/mol. Its IUPAC name is 4-(6-azaspiro[2.5]octan-6-yl)-N-[2-(4,4-difluoropiperidin-1-yl)-6-methylpyrimidin-4-yl]-2-(2-hydroxyethylsulfanylamino)pyrimidine-5-carboxamide.
| Compound Name | 4-(6-azaspiro[2.5]octan-6-yl)-N-[2-(4,4-difluoropiperidin-1-yl)-6-methylpyrimidin-4-yl]-2-(2-hydroxyethylsulfanylamino)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 154959661 |
| Molecular Formula | C24H32F2N8O2S |
| Molecular Weight | 534.64 g/mol |
| Exact Mass | 534.23 |
| IUPAC Name | 4-(6-azaspiro[2.5]octan-6-yl)-N-[2-(4,4-difluoropiperidin-1-yl)-6-methylpyrimidin-4-yl]-2-(2-hydroxyethylsulfanylamino)pyrimidine-5-carboxamide |
| SMILES | Cc1cc(NC(=O)c2cnc(NSCCO)nc2N2CCC3(CC2)CC3)nc(N2CCC(F)(F)CC2)n1 |
| InChI | InChI=1S/C24H32F2N8O2S/c1-16-14-18(30-22(28-16)34-10-6-24(25,26)7-11-34)29-20(36)17-15-27-21(32-37-13-12-35)31-19(17)33-8-4-23(2-3-23)5-9-33/h14-15,35H,2-13H2,1H3,(H,27,31,32)(H,28,29,30,36) |
| InChIKey | XECOZYVVQXURCC-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 119.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.64 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|