C81H46F5N7 — CID 154959693
2,5-bis[2,7-bis(6-phenyl-2-pyridinyl)carbazol-9-yl]-4-(2,3,4,5,6-pentafluorophenyl)benzonitrile (PubChem CID 154959693) has the molecular formula C81H46F5N7 and a molecular weight of 1212.30 g/mol. Its IUPAC name is 2,5-bis[2,7-bis(6-phenyl-2-pyridinyl)carbazol-9-yl]-4-(2,3,4,5,6-pentafluorophenyl)benzonitrile.
| Compound Name | 2,5-bis[2,7-bis(6-phenyl-2-pyridinyl)carbazol-9-yl]-4-(2,3,4,5,6-pentafluorophenyl)benzonitrile |
|---|---|
| PubChem CID | 154959693 |
| Molecular Formula | C81H46F5N7 |
| Molecular Weight | 1212.30 g/mol |
| Exact Mass | 1211.37 |
| IUPAC Name | 2,5-bis[2,7-bis(6-phenyl-2-pyridinyl)carbazol-9-yl]-4-(2,3,4,5,6-pentafluorophenyl)benzonitrile |
| SMILES | N#Cc1cc(-n2c3cc(-c4cccc(-c5ccccc5)n4)ccc3c3ccc(-c4cccc(-c5ccccc5)n4)cc32)c(-c2c(F)c(F)c(F)c(F)c2F)cc1-n1c2cc(-c3cccc(-c4ccccc4)n3)ccc2c2ccc(-c3cccc(-c4ccccc4)n3)cc21 |
| InChI | InChI=1S/C81H46F5N7/c82-77-76(78(83)80(85)81(86)79(77)84)61-46-70(92-71-41-52(66-29-13-25-62(88-66)48-17-5-1-6-18-48)33-37-57(71)58-38-34-53(42-72(58)92)67-30-14-26-63(89-67)49-19-7-2-8-20-49)56(47-87)45-75(61)93-73-43-54(68-31-15-27-64(90-68)50-21-9-3-10-22-50)35-39-59(73)60-40-36-55(44-74(60)93)69-32-16-28-65(91-69)51-23-11-4-12-24-51/h1-46H |
| InChIKey | SNWIUYCZYGLWKV-UHFFFAOYSA-N |
| XLogP | 21.03 |
| TPSA | 85.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 93 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1212.30 |
| LogP ≤ 5 | 21.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|