About 5-cyclopentyl-1-methyl-1,2,4-triazole
5-cyclopentyl-1-methyl-1,2,4-triazole (PubChem CID 15496059) has the molecular formula C8H13N3
and a molecular weight of 151.21 g/mol. Its IUPAC name is 5-cyclopentyl-1-methyl-1,2,4-triazole.
Molecular Properties
| Compound Name | 5-cyclopentyl-1-methyl-1,2,4-triazole |
| PubChem CID | 15496059 |
| Molecular Formula | C8H13N3 |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.11 |
| IUPAC Name | 5-cyclopentyl-1-methyl-1,2,4-triazole |
| SMILES | Cn1ncnc1C1CCCC1 |
| InChI | InChI=1S/C8H13N3/c1-11-8(9-6-10-11)7-4-2-3-5-7/h6-7H,2-5H2,1H3 |
| InChIKey | FMEZOZKTAAHSRD-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-cyclopentyl-1-methyl-1,2,4-triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cyclopentyl-1-methyl-1,2,4-triazole?
The IUPAC name of 5-cyclopentyl-1-methyl-1,2,4-triazole (CID 15496059) is 5-cyclopentyl-1-methyl-1,2,4-triazole.
What is the SMILES notation for 5-cyclopentyl-1-methyl-1,2,4-triazole?
The canonical SMILES for 5-cyclopentyl-1-methyl-1,2,4-triazole is Cn1ncnc1C1CCCC1.
What is the InChIKey of 5-cyclopentyl-1-methyl-1,2,4-triazole?
The InChIKey is FMEZOZKTAAHSRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3/c1-11-8(9-6-10-11)7-4-2-3-5-7/h6-7H,2-5H2,1H3.
What are the key properties of 5-cyclopentyl-1-methyl-1,2,4-triazole?
5-cyclopentyl-1-methyl-1,2,4-triazole has a molecular weight of 151.21 g/mol, XLogP of 1.47, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyclopentyl-1-methyl-1,2,4-triazole is sourced from PubChem (CID 15496059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).