About 5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine
5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine (PubChem CID 15496061) has the molecular formula C6H9N3
and a molecular weight of 123.16 g/mol. Its IUPAC name is 5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine.
Analyze 5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine?
The IUPAC name of 5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine (CID 15496061) is 5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine.
What is the SMILES notation for 5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine?
The canonical SMILES for 5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine is c1nc2n(n1)CCCC2.
What is the InChIKey of 5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine?
The InChIKey is AGBCFJLARPKYOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N3/c1-2-4-9-6(3-1)7-5-8-9/h5H,1-4H2.
What are the key properties of 5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine?
5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine has a molecular weight of 123.16 g/mol, XLogP of 0.61, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine is sourced from PubChem (CID 15496061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).