About 6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[1,5-a]azepine
6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[1,5-a]azepine (PubChem CID 15496062) has the molecular formula C7H11N3
and a molecular weight of 137.19 g/mol. Its IUPAC name is 6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[1,5-a]azepine.
Analyze 6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[1,5-a]azepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[1,5-a]azepine?
The IUPAC name of 6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[1,5-a]azepine (CID 15496062) is 6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[1,5-a]azepine.
What is the SMILES notation for 6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[1,5-a]azepine?
The canonical SMILES for 6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[1,5-a]azepine is c1nc2n(n1)CCCCC2.
What is the InChIKey of 6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[1,5-a]azepine?
The InChIKey is AKRJUOQZWQVALE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N3/c1-2-4-7-8-6-9-10(7)5-3-1/h6H,1-5H2.
What are the key properties of 6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[1,5-a]azepine?
6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[1,5-a]azepine has a molecular weight of 137.19 g/mol, XLogP of 1.00, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[1,5-a]azepine is sourced from PubChem (CID 15496062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).