C20H16F2N4O4 — CID 154961053
(E)-3-[4-[[2-(2-cyano-4,4-difluoropyrrolidin-1-yl)-2-oxoethyl]carbamoyl]quinolin-6-yl]prop-2-enoic acid (PubChem CID 154961053) has the molecular formula C20H16F2N4O4 and a molecular weight of 414.37 g/mol. Its IUPAC name is (E)-3-[4-[[2-(2-cyano-4,4-difluoropyrrolidin-1-yl)-2-oxoethyl]carbamoyl]quinolin-6-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[[2-(2-cyano-4,4-difluoropyrrolidin-1-yl)-2-oxoethyl]carbamoyl]quinolin-6-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 154961053 |
| Molecular Formula | C20H16F2N4O4 |
| Molecular Weight | 414.37 g/mol |
| Exact Mass | 414.11 |
| IUPAC Name | (E)-3-[4-[[2-(2-cyano-4,4-difluoropyrrolidin-1-yl)-2-oxoethyl]carbamoyl]quinolin-6-yl]prop-2-enoic acid |
| SMILES | N#CC1CC(F)(F)CN1C(=O)CNC(=O)c1ccnc2ccc(/C=C/C(=O)O)cc12 |
| InChI | InChI=1S/C20H16F2N4O4/c21-20(22)8-13(9-23)26(11-20)17(27)10-25-19(30)14-5-6-24-16-3-1-12(7-15(14)16)2-4-18(28)29/h1-7,13H,8,10-11H2,(H,25,30)(H,28,29)/b4-2+ |
| InChIKey | NCNQSVZFLXCYJF-DUXPYHPUSA-N |
| XLogP | 1.82 |
| TPSA | 123.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.37 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|