C24H24FN7O2 — CID 154961175
N-(3-amino-3-iminopropyl)-4-[[3-(3-fluoro-4-hydroxyphenyl)imidazo[1,2-a]pyrazin-8-yl]amino]-N,2-dimethylbenzamide (PubChem CID 154961175) has the molecular formula C24H24FN7O2 and a molecular weight of 461.50 g/mol. Its IUPAC name is N-(3-amino-3-iminopropyl)-4-[[3-(3-fluoro-4-hydroxyphenyl)imidazo[1,2-a]pyrazin-8-yl]amino]-N,2-dimethylbenzamide.
| Compound Name | N-(3-amino-3-iminopropyl)-4-[[3-(3-fluoro-4-hydroxyphenyl)imidazo[1,2-a]pyrazin-8-yl]amino]-N,2-dimethylbenzamide |
|---|---|
| PubChem CID | 154961175 |
| Molecular Formula | C24H24FN7O2 |
| Molecular Weight | 461.50 g/mol |
| Exact Mass | 461.20 |
| IUPAC Name | N-(3-amino-3-iminopropyl)-4-[[3-(3-fluoro-4-hydroxyphenyl)imidazo[1,2-a]pyrazin-8-yl]amino]-N,2-dimethylbenzamide |
| SMILES | [H]/N=C(\N)CCN(C)C(=O)c1ccc(Nc2nccn3c(-c4ccc(O)c(F)c4)cnc23)cc1C |
| InChI | InChI=1S/C24H24FN7O2/c1-14-11-16(4-5-17(14)24(34)31(2)9-7-21(26)27)30-22-23-29-13-19(32(23)10-8-28-22)15-3-6-20(33)18(25)12-15/h3-6,8,10-13,33H,7,9H2,1-2H3,(H3,26,27)(H,28,30) |
| InChIKey | YYTLREBGMWRVFZ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 132.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.50 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|