C23H19ClN4O2 — CID 154961562
(E)-1-[4-[[3-(3-chloro-4-methoxyphenyl)imidazo[1,2-a]pyrazin-8-yl]amino]phenyl]but-2-en-1-one (PubChem CID 154961562) has the molecular formula C23H19ClN4O2 and a molecular weight of 418.88 g/mol. Its IUPAC name is (E)-1-[4-[[3-(3-chloro-4-methoxyphenyl)imidazo[1,2-a]pyrazin-8-yl]amino]phenyl]but-2-en-1-one.
| Compound Name | (E)-1-[4-[[3-(3-chloro-4-methoxyphenyl)imidazo[1,2-a]pyrazin-8-yl]amino]phenyl]but-2-en-1-one |
|---|---|
| PubChem CID | 154961562 |
| Molecular Formula | C23H19ClN4O2 |
| Molecular Weight | 418.88 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | (E)-1-[4-[[3-(3-chloro-4-methoxyphenyl)imidazo[1,2-a]pyrazin-8-yl]amino]phenyl]but-2-en-1-one |
| SMILES | C/C=C/C(=O)c1ccc(Nc2nccn3c(-c4ccc(OC)c(Cl)c4)cnc23)cc1 |
| InChI | InChI=1S/C23H19ClN4O2/c1-3-4-20(29)15-5-8-17(9-6-15)27-22-23-26-14-19(28(23)12-11-25-22)16-7-10-21(30-2)18(24)13-16/h3-14H,1-2H3,(H,25,27)/b4-3+ |
| InChIKey | PNQWEDYQURMFPS-ONEGZZNKSA-N |
| XLogP | 5.56 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.88 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|