C20H29N — CID 154961780
N-butan-2-yl-N,3,8,8-tetramethylheptalen-3-amine (PubChem CID 154961780) has the molecular formula C20H29N and a molecular weight of 283.46 g/mol. Its IUPAC name is N-butan-2-yl-N,3,8,8-tetramethylheptalen-3-amine.
| Compound Name | N-butan-2-yl-N,3,8,8-tetramethylheptalen-3-amine |
|---|---|
| PubChem CID | 154961780 |
| Molecular Formula | C20H29N |
| Molecular Weight | 283.46 g/mol |
| Exact Mass | 283.23 |
| IUPAC Name | N-butan-2-yl-N,3,8,8-tetramethylheptalen-3-amine |
| SMILES | CCC(C)N(C)C1(C)C=CC2=C(C=CC(C)(C)C=C2)C=C1 |
| InChI | InChI=1S/C20H29N/c1-7-16(2)21(6)20(5)14-10-17-8-12-19(3,4)13-9-18(17)11-15-20/h8-16H,7H2,1-6H3 |
| InChIKey | GPXXQUVKDNHPBO-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.46 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |