C21H19ClF5NO5 — CID 154962604
2-[15-chloro-4-oxo-10-(trifluoromethyl)-8-oxa-5-azatricyclo[10.4.0.02,7]hexadeca-1(12),2,6,13,15-pentaen-5-yl]-4-(2,2-difluoroethoxy)butanoic acid (PubChem CID 154962604) has the molecular formula C21H19ClF5NO5 and a molecular weight of 495.83 g/mol. Its IUPAC name is 2-[15-chloro-4-oxo-10-(trifluoromethyl)-8-oxa-5-azatricyclo[10.4.0.02,7]hexadeca-1(12),2,6,13,15-pentaen-5-yl]-4-(2,2-difluoroethoxy)butanoic acid.
| Compound Name | 2-[15-chloro-4-oxo-10-(trifluoromethyl)-8-oxa-5-azatricyclo[10.4.0.02,7]hexadeca-1(12),2,6,13,15-pentaen-5-yl]-4-(2,2-difluoroethoxy)butanoic acid |
|---|---|
| PubChem CID | 154962604 |
| Molecular Formula | C21H19ClF5NO5 |
| Molecular Weight | 495.83 g/mol |
| Exact Mass | 495.09 |
| IUPAC Name | 2-[15-chloro-4-oxo-10-(trifluoromethyl)-8-oxa-5-azatricyclo[10.4.0.02,7]hexadeca-1(12),2,6,13,15-pentaen-5-yl]-4-(2,2-difluoroethoxy)butanoic acid |
| SMILES | O=C(O)C(CCOCC(F)F)n1cc2c(cc1=O)-c1cc(Cl)ccc1CC(C(F)(F)F)CO2 |
| InChI | InChI=1S/C21H19ClF5NO5/c22-13-2-1-11-5-12(21(25,26)27)9-33-17-8-28(19(29)7-15(17)14(11)6-13)16(20(30)31)3-4-32-10-18(23)24/h1-2,6-8,12,16,18H,3-5,9-10H2,(H,30,31) |
| InChIKey | DEFAFJOLXCTURT-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.83 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|