C25H27ClF3NO5 — CID 154962677
ethyl 2-[15-chloro-4-oxo-10-(trifluoromethyl)-8-oxa-5-azatricyclo[10.4.0.02,7]hexadeca-1(12),2,6,13,15-pentaen-5-yl]-4-cyclobutyloxybutanoate (PubChem CID 154962677) has the molecular formula C25H27ClF3NO5 and a molecular weight of 513.94 g/mol. Its IUPAC name is ethyl 2-[15-chloro-4-oxo-10-(trifluoromethyl)-8-oxa-5-azatricyclo[10.4.0.02,7]hexadeca-1(12),2,6,13,15-pentaen-5-yl]-4-cyclobutyloxybutanoate.
| Compound Name | ethyl 2-[15-chloro-4-oxo-10-(trifluoromethyl)-8-oxa-5-azatricyclo[10.4.0.02,7]hexadeca-1(12),2,6,13,15-pentaen-5-yl]-4-cyclobutyloxybutanoate |
|---|---|
| PubChem CID | 154962677 |
| Molecular Formula | C25H27ClF3NO5 |
| Molecular Weight | 513.94 g/mol |
| Exact Mass | 513.15 |
| IUPAC Name | ethyl 2-[15-chloro-4-oxo-10-(trifluoromethyl)-8-oxa-5-azatricyclo[10.4.0.02,7]hexadeca-1(12),2,6,13,15-pentaen-5-yl]-4-cyclobutyloxybutanoate |
| SMILES | CCOC(=O)C(CCOC1CCC1)n1cc2c(cc1=O)-c1cc(Cl)ccc1CC(C(F)(F)F)CO2 |
| InChI | InChI=1S/C25H27ClF3NO5/c1-2-33-24(32)21(8-9-34-18-4-3-5-18)30-13-22-20(12-23(30)31)19-11-17(26)7-6-15(19)10-16(14-35-22)25(27,28)29/h6-7,11-13,16,18,21H,2-5,8-10,14H2,1H3 |
| InChIKey | VUTSFEUCKAFRIU-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 66.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.94 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |