C13H20N4O3 — CID 154962683
tert-butyl N-[(2Z)-2-[formyl(methyl)hydrazinylidene]-1-methyl-4-pyridinyl]carbamate (PubChem CID 154962683) has the molecular formula C13H20N4O3 and a molecular weight of 280.33 g/mol. Its IUPAC name is tert-butyl N-[(2Z)-2-[formyl(methyl)hydrazinylidene]-1-methyl-4-pyridinyl]carbamate.
| Compound Name | tert-butyl N-[(2Z)-2-[formyl(methyl)hydrazinylidene]-1-methyl-4-pyridinyl]carbamate |
|---|---|
| PubChem CID | 154962683 |
| Molecular Formula | C13H20N4O3 |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | tert-butyl N-[(2Z)-2-[formyl(methyl)hydrazinylidene]-1-methyl-4-pyridinyl]carbamate |
| SMILES | CN(C=O)/N=c1/cc(NC(=O)OC(C)(C)C)ccn1C |
| InChI | InChI=1S/C13H20N4O3/c1-13(2,3)20-12(19)14-10-6-7-16(4)11(8-10)15-17(5)9-18/h6-9H,1-5H3,(H,14,19)/b15-11- |
| InChIKey | JRISTANQULMHPV-PTNGSMBKSA-N |
| XLogP | 1.28 |
| TPSA | 75.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|