C24H26O5 — CID 154963978
[(1S,5R,13R,17R)-17-hydroxy-10-methoxy-12-oxapentacyclo[9.6.1.01,13.05,17.07,18]octadeca-7(18),8,10,14-tetraen-14-yl] (2E,4E)-hexa-2,4-dienoate (PubChem CID 154963978) has the molecular formula C24H26O5 and a molecular weight of 394.47 g/mol. Its IUPAC name is [(1S,5R,13R,17R)-17-hydroxy-10-methoxy-12-oxapentacyclo[9.6.1.01,13.05,17.07,18]octadeca-7(18),8,10,14-tetraen-14-yl] (2E,4E)-hexa-2,4-dienoate.
| Compound Name | [(1S,5R,13R,17R)-17-hydroxy-10-methoxy-12-oxapentacyclo[9.6.1.01,13.05,17.07,18]octadeca-7(18),8,10,14-tetraen-14-yl] (2E,4E)-hexa-2,4-dienoate |
|---|---|
| PubChem CID | 154963978 |
| Molecular Formula | C24H26O5 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | [(1S,5R,13R,17R)-17-hydroxy-10-methoxy-12-oxapentacyclo[9.6.1.01,13.05,17.07,18]octadeca-7(18),8,10,14-tetraen-14-yl] (2E,4E)-hexa-2,4-dienoate |
| SMILES | C/C=C/C=C/C(=O)OC1=CC[C@@]2(O)[C@@H]3CCC[C@@]24c2c(ccc(OC)c2O[C@@H]14)C3 |
| InChI | InChI=1S/C24H26O5/c1-3-4-5-8-19(25)28-18-11-13-24(26)16-7-6-12-23(24)20-15(14-16)9-10-17(27-2)21(20)29-22(18)23/h3-5,8-11,16,22,26H,6-7,12-14H2,1-2H3/b4-3+,8-5+/t16-,22+,23+,24-/m1/s1 |
| InChIKey | MIEPEHXPBRVWDI-WJVYWAMZSA-N |
| XLogP | 3.74 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|