About 2-tert-butyl-7-methyl-7,7a-dihydrothieno[2,3-c]pyridine
2-tert-butyl-7-methyl-7,7a-dihydrothieno[2,3-c]pyridine (PubChem CID 154964078) has the molecular formula C12H17NS
and a molecular weight of 207.34 g/mol. Its IUPAC name is 2-tert-butyl-7-methyl-7,7a-dihydrothieno[2,3-c]pyridine.
Molecular Properties
| Compound Name | 2-tert-butyl-7-methyl-7,7a-dihydrothieno[2,3-c]pyridine |
| PubChem CID | 154964078 |
| Molecular Formula | C12H17NS |
| Molecular Weight | 207.34 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | 2-tert-butyl-7-methyl-7,7a-dihydrothieno[2,3-c]pyridine |
| SMILES | CC1N=CC=C2C=C(C(C)(C)C)SC21 |
| InChI | InChI=1S/C12H17NS/c1-8-11-9(5-6-13-8)7-10(14-11)12(2,3)4/h5-8,11H,1-4H3 |
| InChIKey | XEDPFOFAMRMWHA-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.34 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-tert-butyl-7-methyl-7,7a-dihydrothieno[2,3-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-7-methyl-7,7a-dihydrothieno[2,3-c]pyridine?
The IUPAC name of 2-tert-butyl-7-methyl-7,7a-dihydrothieno[2,3-c]pyridine (CID 154964078) is 2-tert-butyl-7-methyl-7,7a-dihydrothieno[2,3-c]pyridine.
What is the SMILES notation for 2-tert-butyl-7-methyl-7,7a-dihydrothieno[2,3-c]pyridine?
The canonical SMILES for 2-tert-butyl-7-methyl-7,7a-dihydrothieno[2,3-c]pyridine is CC1N=CC=C2C=C(C(C)(C)C)SC21.
What is the InChIKey of 2-tert-butyl-7-methyl-7,7a-dihydrothieno[2,3-c]pyridine?
The InChIKey is XEDPFOFAMRMWHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NS/c1-8-11-9(5-6-13-8)7-10(14-11)12(2,3)4/h5-8,11H,1-4H3.
What are the key properties of 2-tert-butyl-7-methyl-7,7a-dihydrothieno[2,3-c]pyridine?
2-tert-butyl-7-methyl-7,7a-dihydrothieno[2,3-c]pyridine has a molecular weight of 207.34 g/mol, XLogP of 3.43, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-7-methyl-7,7a-dihydrothieno[2,3-c]pyridine is sourced from PubChem (CID 154964078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).