C19H22FN3O2S — CID 154964360
ethyl (4R)-4-[(3Z,5E)-5-fluorohepta-1,3,5-trien-2-yl]-4,6-dimethyl-2-(1,3-thiazol-2-yl)-1H-pyrimidine-5-carboxylate (PubChem CID 154964360) has the molecular formula C19H22FN3O2S and a molecular weight of 375.47 g/mol. Its IUPAC name is ethyl (4R)-4-[(3Z,5E)-5-fluorohepta-1,3,5-trien-2-yl]-4,6-dimethyl-2-(1,3-thiazol-2-yl)-1H-pyrimidine-5-carboxylate.
| Compound Name | ethyl (4R)-4-[(3Z,5E)-5-fluorohepta-1,3,5-trien-2-yl]-4,6-dimethyl-2-(1,3-thiazol-2-yl)-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 154964360 |
| Molecular Formula | C19H22FN3O2S |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | ethyl (4R)-4-[(3Z,5E)-5-fluorohepta-1,3,5-trien-2-yl]-4,6-dimethyl-2-(1,3-thiazol-2-yl)-1H-pyrimidine-5-carboxylate |
| SMILES | C=C(/C=C\C(F)=C/C)[C@@]1(C)N=C(c2nccs2)NC(C)=C1C(=O)OCC |
| InChI | InChI=1S/C19H22FN3O2S/c1-6-14(20)9-8-12(3)19(5)15(18(24)25-7-2)13(4)22-16(23-19)17-21-10-11-26-17/h6,8-11H,3,7H2,1-2,4-5H3,(H,22,23)/b9-8-,14-6+/t19-/m1/s1 |
| InChIKey | HNSSSDXEEDETKW-OJYRQCAPSA-N |
| XLogP | 4.07 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|