C14H28N2S — CID 154964541
N'-[(2E)-3,7-dimethylocta-2,6-dienyl]-N'-ethylsulfanylethane-1,2-diamine (PubChem CID 154964541) has the molecular formula C14H28N2S and a molecular weight of 256.46 g/mol. Its IUPAC name is N'-[(2E)-3,7-dimethylocta-2,6-dienyl]-N'-ethylsulfanylethane-1,2-diamine.
| Compound Name | N'-[(2E)-3,7-dimethylocta-2,6-dienyl]-N'-ethylsulfanylethane-1,2-diamine |
|---|---|
| PubChem CID | 154964541 |
| Molecular Formula | C14H28N2S |
| Molecular Weight | 256.46 g/mol |
| Exact Mass | 256.20 |
| IUPAC Name | N'-[(2E)-3,7-dimethylocta-2,6-dienyl]-N'-ethylsulfanylethane-1,2-diamine |
| SMILES | CCSN(C/C=C(\C)CCC=C(C)C)CCN |
| InChI | InChI=1S/C14H28N2S/c1-5-17-16(12-10-15)11-9-14(4)8-6-7-13(2)3/h7,9H,5-6,8,10-12,15H2,1-4H3/b14-9+ |
| InChIKey | NSAFZXAZYTWCOZ-NTEUORMPSA-N |
| XLogP | 3.61 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.46 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|