About (3E)-4-ethylsulfanyl-3-fluoro-5,5-dimethylhexa-1,3-diene
(3E)-4-ethylsulfanyl-3-fluoro-5,5-dimethylhexa-1,3-diene (PubChem CID 154964906) has the molecular formula C10H17FS
and a molecular weight of 188.31 g/mol. Its IUPAC name is (3E)-4-ethylsulfanyl-3-fluoro-5,5-dimethylhexa-1,3-diene.
Molecular Properties
| Compound Name | (3E)-4-ethylsulfanyl-3-fluoro-5,5-dimethylhexa-1,3-diene |
| PubChem CID | 154964906 |
| Molecular Formula | C10H17FS |
| Molecular Weight | 188.31 g/mol |
| Exact Mass | 188.10 |
| IUPAC Name | (3E)-4-ethylsulfanyl-3-fluoro-5,5-dimethylhexa-1,3-diene |
| SMILES | C=C/C(F)=C(\SCC)C(C)(C)C |
| InChI | InChI=1S/C10H17FS/c1-6-8(11)9(12-7-2)10(3,4)5/h6H,1,7H2,2-5H3/b9-8+ |
| InChIKey | VUPBRSIJZORBJZ-CMDGGOBGSA-N |
| XLogP | 4.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.31 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3E)-4-ethylsulfanyl-3-fluoro-5,5-dimethylhexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-4-ethylsulfanyl-3-fluoro-5,5-dimethylhexa-1,3-diene?
The IUPAC name of (3E)-4-ethylsulfanyl-3-fluoro-5,5-dimethylhexa-1,3-diene (CID 154964906) is (3E)-4-ethylsulfanyl-3-fluoro-5,5-dimethylhexa-1,3-diene.
What is the SMILES notation for (3E)-4-ethylsulfanyl-3-fluoro-5,5-dimethylhexa-1,3-diene?
The canonical SMILES for (3E)-4-ethylsulfanyl-3-fluoro-5,5-dimethylhexa-1,3-diene is C=C/C(F)=C(\SCC)C(C)(C)C.
What is the InChIKey of (3E)-4-ethylsulfanyl-3-fluoro-5,5-dimethylhexa-1,3-diene?
The InChIKey is VUPBRSIJZORBJZ-CMDGGOBGSA-N. The full InChI is InChI=1S/C10H17FS/c1-6-8(11)9(12-7-2)10(3,4)5/h6H,1,7H2,2-5H3/b9-8+.
What are the key properties of (3E)-4-ethylsulfanyl-3-fluoro-5,5-dimethylhexa-1,3-diene?
(3E)-4-ethylsulfanyl-3-fluoro-5,5-dimethylhexa-1,3-diene has a molecular weight of 188.31 g/mol, XLogP of 4.15, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-4-ethylsulfanyl-3-fluoro-5,5-dimethylhexa-1,3-diene is sourced from PubChem (CID 154964906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).