About (2Z,4Z)-2-tert-butyl-N-[(E)-3-methylbut-1-enyl]hexa-2,4-dienimidoyl chloride
(2Z,4Z)-2-tert-butyl-N-[(E)-3-methylbut-1-enyl]hexa-2,4-dienimidoyl chloride (PubChem CID 154964909) has the molecular formula C15H24ClN
and a molecular weight of 253.82 g/mol. Its IUPAC name is (2Z,4Z)-2-tert-butyl-N-[(E)-3-methylbut-1-enyl]hexa-2,4-dienimidoyl chloride.
Molecular Properties
| Compound Name | (2Z,4Z)-2-tert-butyl-N-[(E)-3-methylbut-1-enyl]hexa-2,4-dienimidoyl chloride |
| PubChem CID | 154964909 |
| Molecular Formula | C15H24ClN |
| Molecular Weight | 253.82 g/mol |
| Exact Mass | 253.16 |
| IUPAC Name | (2Z,4Z)-2-tert-butyl-N-[(E)-3-methylbut-1-enyl]hexa-2,4-dienimidoyl chloride |
| SMILES | C/C=C\C=C(C(/Cl)=N/C=C/C(C)C)\C(C)(C)C |
| InChI | InChI=1S/C15H24ClN/c1-7-8-9-13(15(4,5)6)14(16)17-11-10-12(2)3/h7-12H,1-6H3/b8-7-,11-10+,13-9+,17-14- |
| InChIKey | QIEFYQJEXPGIME-RWGVIKRFSA-N |
| XLogP | 5.34 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 253.82 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2Z,4Z)-2-tert-butyl-N-[(E)-3-methylbut-1-enyl]hexa-2,4-dienimidoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z,4Z)-2-tert-butyl-N-[(E)-3-methylbut-1-enyl]hexa-2,4-dienimidoyl chloride?
The IUPAC name of (2Z,4Z)-2-tert-butyl-N-[(E)-3-methylbut-1-enyl]hexa-2,4-dienimidoyl chloride (CID 154964909) is (2Z,4Z)-2-tert-butyl-N-[(E)-3-methylbut-1-enyl]hexa-2,4-dienimidoyl chloride.
What is the SMILES notation for (2Z,4Z)-2-tert-butyl-N-[(E)-3-methylbut-1-enyl]hexa-2,4-dienimidoyl chloride?
The canonical SMILES for (2Z,4Z)-2-tert-butyl-N-[(E)-3-methylbut-1-enyl]hexa-2,4-dienimidoyl chloride is C/C=C\C=C(C(/Cl)=N/C=C/C(C)C)\C(C)(C)C.
What is the InChIKey of (2Z,4Z)-2-tert-butyl-N-[(E)-3-methylbut-1-enyl]hexa-2,4-dienimidoyl chloride?
The InChIKey is QIEFYQJEXPGIME-RWGVIKRFSA-N. The full InChI is InChI=1S/C15H24ClN/c1-7-8-9-13(15(4,5)6)14(16)17-11-10-12(2)3/h7-12H,1-6H3/b8-7-,11-10+,13-9+,17-14-.
What are the key properties of (2Z,4Z)-2-tert-butyl-N-[(E)-3-methylbut-1-enyl]hexa-2,4-dienimidoyl chloride?
(2Z,4Z)-2-tert-butyl-N-[(E)-3-methylbut-1-enyl]hexa-2,4-dienimidoyl chloride has a molecular weight of 253.82 g/mol, XLogP of 5.34, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z,4Z)-2-tert-butyl-N-[(E)-3-methylbut-1-enyl]hexa-2,4-dienimidoyl chloride is sourced from PubChem (CID 154964909), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).