About N-ethyl-1,4-dimethylpyridin-2-imine
N-ethyl-1,4-dimethylpyridin-2-imine (PubChem CID 154965039) has the molecular formula C9H14N2
and a molecular weight of 150.22 g/mol. Its IUPAC name is N-ethyl-1,4-dimethylpyridin-2-imine.
Molecular Properties
| Compound Name | N-ethyl-1,4-dimethylpyridin-2-imine |
| PubChem CID | 154965039 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | N-ethyl-1,4-dimethylpyridin-2-imine |
| SMILES | CC/N=c1\cc(C)ccn1C |
| InChI | InChI=1S/C9H14N2/c1-4-10-9-7-8(2)5-6-11(9)3/h5-7H,4H2,1-3H3/b10-9+ |
| InChIKey | QIRHEPQUEALCSB-MDZDMXLPSA-N |
| XLogP | 1.25 |
| TPSA | 17.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-ethyl-1,4-dimethylpyridin-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-1,4-dimethylpyridin-2-imine?
The IUPAC name of N-ethyl-1,4-dimethylpyridin-2-imine (CID 154965039) is N-ethyl-1,4-dimethylpyridin-2-imine.
What is the SMILES notation for N-ethyl-1,4-dimethylpyridin-2-imine?
The canonical SMILES for N-ethyl-1,4-dimethylpyridin-2-imine is CC/N=c1\cc(C)ccn1C.
What is the InChIKey of N-ethyl-1,4-dimethylpyridin-2-imine?
The InChIKey is QIRHEPQUEALCSB-MDZDMXLPSA-N. The full InChI is InChI=1S/C9H14N2/c1-4-10-9-7-8(2)5-6-11(9)3/h5-7H,4H2,1-3H3/b10-9+.
What are the key properties of N-ethyl-1,4-dimethylpyridin-2-imine?
N-ethyl-1,4-dimethylpyridin-2-imine has a molecular weight of 150.22 g/mol, XLogP of 1.25, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-1,4-dimethylpyridin-2-imine is sourced from PubChem (CID 154965039), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).