About 1-[(3E)-5-fluorohexa-3,5-dien-3-yl]pyrazole
1-[(3E)-5-fluorohexa-3,5-dien-3-yl]pyrazole (PubChem CID 154965197) has the molecular formula C9H11FN2
and a molecular weight of 166.20 g/mol. Its IUPAC name is 1-[(3E)-5-fluorohexa-3,5-dien-3-yl]pyrazole.
Molecular Properties
| Compound Name | 1-[(3E)-5-fluorohexa-3,5-dien-3-yl]pyrazole |
| PubChem CID | 154965197 |
| Molecular Formula | C9H11FN2 |
| Molecular Weight | 166.20 g/mol |
| Exact Mass | 166.09 |
| IUPAC Name | 1-[(3E)-5-fluorohexa-3,5-dien-3-yl]pyrazole |
| SMILES | C=C(F)/C=C(\CC)n1cccn1 |
| InChI | InChI=1S/C9H11FN2/c1-3-9(7-8(2)10)12-6-4-5-11-12/h4-7H,2-3H2,1H3/b9-7+ |
| InChIKey | RUNHBCVUIFXZDT-VQHVLOKHSA-N |
| XLogP | 2.62 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.20 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(3E)-5-fluorohexa-3,5-dien-3-yl]pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3E)-5-fluorohexa-3,5-dien-3-yl]pyrazole?
The IUPAC name of 1-[(3E)-5-fluorohexa-3,5-dien-3-yl]pyrazole (CID 154965197) is 1-[(3E)-5-fluorohexa-3,5-dien-3-yl]pyrazole.
What is the SMILES notation for 1-[(3E)-5-fluorohexa-3,5-dien-3-yl]pyrazole?
The canonical SMILES for 1-[(3E)-5-fluorohexa-3,5-dien-3-yl]pyrazole is C=C(F)/C=C(\CC)n1cccn1.
What is the InChIKey of 1-[(3E)-5-fluorohexa-3,5-dien-3-yl]pyrazole?
The InChIKey is RUNHBCVUIFXZDT-VQHVLOKHSA-N. The full InChI is InChI=1S/C9H11FN2/c1-3-9(7-8(2)10)12-6-4-5-11-12/h4-7H,2-3H2,1H3/b9-7+.
What are the key properties of 1-[(3E)-5-fluorohexa-3,5-dien-3-yl]pyrazole?
1-[(3E)-5-fluorohexa-3,5-dien-3-yl]pyrazole has a molecular weight of 166.20 g/mol, XLogP of 2.62, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3E)-5-fluorohexa-3,5-dien-3-yl]pyrazole is sourced from PubChem (CID 154965197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).