C8H14FNO2 — CID 154965501
(7aR)-6-fluoro-3,3-dimethyl-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-ol (PubChem CID 154965501) has the molecular formula C8H14FNO2 and a molecular weight of 175.20 g/mol. Its IUPAC name is (7aR)-6-fluoro-3,3-dimethyl-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-ol.
| Compound Name | (7aR)-6-fluoro-3,3-dimethyl-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-ol |
|---|---|
| PubChem CID | 154965501 |
| Molecular Formula | C8H14FNO2 |
| Molecular Weight | 175.20 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | (7aR)-6-fluoro-3,3-dimethyl-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-ol |
| SMILES | CC1(C)OC[C@H]2CC(F)C(O)N21 |
| InChI | InChI=1S/C8H14FNO2/c1-8(2)10-5(4-12-8)3-6(9)7(10)11/h5-7,11H,3-4H2,1-2H3/t5-,6?,7?/m1/s1 |
| InChIKey | REQHHCVYWNUFKL-GRQBKTHUSA-N |
| XLogP | 0.48 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.20 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |