About 2-tert-butyl-2,6-dimethyl-3H-pyridine
2-tert-butyl-2,6-dimethyl-3H-pyridine (PubChem CID 154966014) has the molecular formula C11H19N
and a molecular weight of 165.28 g/mol. Its IUPAC name is 2-tert-butyl-2,6-dimethyl-3H-pyridine.
Molecular Properties
| Compound Name | 2-tert-butyl-2,6-dimethyl-3H-pyridine |
| PubChem CID | 154966014 |
| Molecular Formula | C11H19N |
| Molecular Weight | 165.28 g/mol |
| Exact Mass | 165.15 |
| IUPAC Name | 2-tert-butyl-2,6-dimethyl-3H-pyridine |
| SMILES | CC1=NC(C)(C(C)(C)C)CC=C1 |
| InChI | InChI=1S/C11H19N/c1-9-7-6-8-11(5,12-9)10(2,3)4/h6-7H,8H2,1-5H3 |
| InChIKey | DGQJSWVNBYCCED-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.28 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-tert-butyl-2,6-dimethyl-3H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-2,6-dimethyl-3H-pyridine?
The IUPAC name of 2-tert-butyl-2,6-dimethyl-3H-pyridine (CID 154966014) is 2-tert-butyl-2,6-dimethyl-3H-pyridine.
What is the SMILES notation for 2-tert-butyl-2,6-dimethyl-3H-pyridine?
The canonical SMILES for 2-tert-butyl-2,6-dimethyl-3H-pyridine is CC1=NC(C)(C(C)(C)C)CC=C1.
What is the InChIKey of 2-tert-butyl-2,6-dimethyl-3H-pyridine?
The InChIKey is DGQJSWVNBYCCED-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N/c1-9-7-6-8-11(5,12-9)10(2,3)4/h6-7H,8H2,1-5H3.
What are the key properties of 2-tert-butyl-2,6-dimethyl-3H-pyridine?
2-tert-butyl-2,6-dimethyl-3H-pyridine has a molecular weight of 165.28 g/mol, XLogP of 3.21, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-2,6-dimethyl-3H-pyridine is sourced from PubChem (CID 154966014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).