C16H23N5 — CID 154966165
6-[(4-methyl-6,7-dihydro-5H-pyrrolo[3,4-b]pyridin-2-yl)methyl]-3,4,6,7,8,9-hexahydro-2H-pyrimido[1,2-a]pyrimidine (PubChem CID 154966165) has the molecular formula C16H23N5 and a molecular weight of 285.39 g/mol. Its IUPAC name is 6-[(4-methyl-6,7-dihydro-5H-pyrrolo[3,4-b]pyridin-2-yl)methyl]-3,4,6,7,8,9-hexahydro-2H-pyrimido[1,2-a]pyrimidine.
| Compound Name | 6-[(4-methyl-6,7-dihydro-5H-pyrrolo[3,4-b]pyridin-2-yl)methyl]-3,4,6,7,8,9-hexahydro-2H-pyrimido[1,2-a]pyrimidine |
|---|---|
| PubChem CID | 154966165 |
| Molecular Formula | C16H23N5 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.20 |
| IUPAC Name | 6-[(4-methyl-6,7-dihydro-5H-pyrrolo[3,4-b]pyridin-2-yl)methyl]-3,4,6,7,8,9-hexahydro-2H-pyrimido[1,2-a]pyrimidine |
| SMILES | Cc1cc(CC2CCNC3=NCCCN32)nc2c1CNC2 |
| InChI | InChI=1S/C16H23N5/c1-11-7-12(20-15-10-17-9-14(11)15)8-13-3-5-19-16-18-4-2-6-21(13)16/h7,13,17H,2-6,8-10H2,1H3,(H,18,19) |
| InChIKey | PMEXANREIRBGIP-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |