About [4-[4-[(3,4-difluorophenyl)methyl]piperazin-1-yl]oxan-4-yl]-pyridin-2-ylmethanol
[4-[4-[(3,4-difluorophenyl)methyl]piperazin-1-yl]oxan-4-yl]-pyridin-2-ylmethanol (PubChem CID 154966420) has the molecular formula C22H27F2N3O2
and a molecular weight of 403.47 g/mol. Its IUPAC name is [4-[4-[(3,4-difluorophenyl)methyl]piperazin-1-yl]oxan-4-yl]-pyridin-2-ylmethanol.
Molecular Properties
| Compound Name | [4-[4-[(3,4-difluorophenyl)methyl]piperazin-1-yl]oxan-4-yl]-pyridin-2-ylmethanol |
| PubChem CID | 154966420 |
| Molecular Formula | C22H27F2N3O2 |
| Molecular Weight | 403.47 g/mol |
| Exact Mass | 403.21 |
| IUPAC Name | [4-[4-[(3,4-difluorophenyl)methyl]piperazin-1-yl]oxan-4-yl]-pyridin-2-ylmethanol |
| SMILES | OC(c1ccccn1)C1(N2CCN(Cc3ccc(F)c(F)c3)CC2)CCOCC1 |
| InChI | InChI=1S/C22H27F2N3O2/c23-18-5-4-17(15-19(18)24)16-26-9-11-27(12-10-26)22(6-13-29-14-7-22)21(28)20-3-1-2-8-25-20/h1-5,8,15,21,28H,6-7,9-14,16H2 |
| InChIKey | MJQRQNUXHGPEFS-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 48.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.47 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [4-[4-[(3,4-difluorophenyl)methyl]piperazin-1-yl]oxan-4-yl]-pyridin-2-ylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[4-[(3,4-difluorophenyl)methyl]piperazin-1-yl]oxan-4-yl]-pyridin-2-ylmethanol?
The IUPAC name of [4-[4-[(3,4-difluorophenyl)methyl]piperazin-1-yl]oxan-4-yl]-pyridin-2-ylmethanol (CID 154966420) is [4-[4-[(3,4-difluorophenyl)methyl]piperazin-1-yl]oxan-4-yl]-pyridin-2-ylmethanol.
What is the SMILES notation for [4-[4-[(3,4-difluorophenyl)methyl]piperazin-1-yl]oxan-4-yl]-pyridin-2-ylmethanol?
The canonical SMILES for [4-[4-[(3,4-difluorophenyl)methyl]piperazin-1-yl]oxan-4-yl]-pyridin-2-ylmethanol is OC(c1ccccn1)C1(N2CCN(Cc3ccc(F)c(F)c3)CC2)CCOCC1.
What is the InChIKey of [4-[4-[(3,4-difluorophenyl)methyl]piperazin-1-yl]oxan-4-yl]-pyridin-2-ylmethanol?
The InChIKey is MJQRQNUXHGPEFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H27F2N3O2/c23-18-5-4-17(15-19(18)24)16-26-9-11-27(12-10-26)22(6-13-29-14-7-22)21(28)20-3-1-2-8-25-20/h1-5,8,15,21,28H,6-7,9-14,16H2.
What are the key properties of [4-[4-[(3,4-difluorophenyl)methyl]piperazin-1-yl]oxan-4-yl]-pyridin-2-ylmethanol?
[4-[4-[(3,4-difluorophenyl)methyl]piperazin-1-yl]oxan-4-yl]-pyridin-2-ylmethanol has a molecular weight of 403.47 g/mol, XLogP of 2.76, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[4-[(3,4-difluorophenyl)methyl]piperazin-1-yl]oxan-4-yl]-pyridin-2-ylmethanol is sourced from PubChem (CID 154966420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).