About 8-tert-butyl-2,6-dichloro-4-phenyl-1,2λ5-benzoxaphosphinine 2-oxide
8-tert-butyl-2,6-dichloro-4-phenyl-1,2λ5-benzoxaphosphinine 2-oxide (PubChem CID 15496683) has the molecular formula C18H17Cl2O2P
and a molecular weight of 367.21 g/mol. Its IUPAC name is 8-tert-butyl-2,6-dichloro-4-phenyl-1,2λ5-benzoxaphosphinine 2-oxide.
Molecular Properties
| Compound Name | 8-tert-butyl-2,6-dichloro-4-phenyl-1,2λ5-benzoxaphosphinine 2-oxide |
| PubChem CID | 15496683 |
| Molecular Formula | C18H17Cl2O2P |
| Molecular Weight | 367.21 g/mol |
| Exact Mass | 366.03 |
| IUPAC Name | 8-tert-butyl-2,6-dichloro-4-phenyl-1,2λ5-benzoxaphosphinine 2-oxide |
| SMILES | CC(C)(C)c1cc(Cl)cc2c1OP(=O)(Cl)C=C2c1ccccc1 |
| InChI | InChI=1S/C18H17Cl2O2P/c1-18(2,3)16-10-13(19)9-14-15(12-7-5-4-6-8-12)11-23(20,21)22-17(14)16/h4-11H,1-3H3 |
| InChIKey | RAQCMTGOFHTTQS-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 367.21 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 8-tert-butyl-2,6-dichloro-4-phenyl-1,2λ5-benzoxaphosphinine 2-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-tert-butyl-2,6-dichloro-4-phenyl-1,2λ5-benzoxaphosphinine 2-oxide?
The IUPAC name of 8-tert-butyl-2,6-dichloro-4-phenyl-1,2λ5-benzoxaphosphinine 2-oxide (CID 15496683) is 8-tert-butyl-2,6-dichloro-4-phenyl-1,2λ5-benzoxaphosphinine 2-oxide.
What is the SMILES notation for 8-tert-butyl-2,6-dichloro-4-phenyl-1,2λ5-benzoxaphosphinine 2-oxide?
The canonical SMILES for 8-tert-butyl-2,6-dichloro-4-phenyl-1,2λ5-benzoxaphosphinine 2-oxide is CC(C)(C)c1cc(Cl)cc2c1OP(=O)(Cl)C=C2c1ccccc1.
What is the InChIKey of 8-tert-butyl-2,6-dichloro-4-phenyl-1,2λ5-benzoxaphosphinine 2-oxide?
The InChIKey is RAQCMTGOFHTTQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17Cl2O2P/c1-18(2,3)16-10-13(19)9-14-15(12-7-5-4-6-8-12)11-23(20,21)22-17(14)16/h4-11H,1-3H3.
What are the key properties of 8-tert-butyl-2,6-dichloro-4-phenyl-1,2λ5-benzoxaphosphinine 2-oxide?
8-tert-butyl-2,6-dichloro-4-phenyl-1,2λ5-benzoxaphosphinine 2-oxide has a molecular weight of 367.21 g/mol, XLogP of 6.85, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-tert-butyl-2,6-dichloro-4-phenyl-1,2λ5-benzoxaphosphinine 2-oxide is sourced from PubChem (CID 15496683), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).