C16HF5N4 — CID 154967323
2-[6-(dicyanomethylidene)-1,3,5,7,8-pentafluoronaphthalen-2-ylidene]propanedinitrile (PubChem CID 154967323) has the molecular formula C16HF5N4 and a molecular weight of 344.20 g/mol. Its IUPAC name is 2-[6-(dicyanomethylidene)-1,3,5,7,8-pentafluoronaphthalen-2-ylidene]propanedinitrile.
| Compound Name | 2-[6-(dicyanomethylidene)-1,3,5,7,8-pentafluoronaphthalen-2-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 154967323 |
| Molecular Formula | C16HF5N4 |
| Molecular Weight | 344.20 g/mol |
| Exact Mass | 344.01 |
| IUPAC Name | 2-[6-(dicyanomethylidene)-1,3,5,7,8-pentafluoronaphthalen-2-ylidene]propanedinitrile |
| SMILES | N#CC(C#N)=c1c(F)c(F)c2c(F)c(=C(C#N)C#N)c(F)cc2c1F |
| InChI | InChI=1S/C16HF5N4/c17-9-1-8-12(14(19)10(9)6(2-22)3-23)16(21)15(20)11(13(8)18)7(4-24)5-25/h1H |
| InChIKey | KICDQZHJDOSMFI-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 95.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.20 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|