C14H14N4O3 — CID 154967477
(3S)-3-[(2-oxo-2-pyrazolo[1,5-a]pyridin-3-ylethyl)amino]piperidine-2,6-dione (PubChem CID 154967477) has the molecular formula C14H14N4O3 and a molecular weight of 286.29 g/mol. Its IUPAC name is (3S)-3-[(2-oxo-2-pyrazolo[1,5-a]pyridin-3-ylethyl)amino]piperidine-2,6-dione.
| Compound Name | (3S)-3-[(2-oxo-2-pyrazolo[1,5-a]pyridin-3-ylethyl)amino]piperidine-2,6-dione |
|---|---|
| PubChem CID | 154967477 |
| Molecular Formula | C14H14N4O3 |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | (3S)-3-[(2-oxo-2-pyrazolo[1,5-a]pyridin-3-ylethyl)amino]piperidine-2,6-dione |
| SMILES | O=C1CC[C@H](NCC(=O)c2cnn3ccccc23)C(=O)N1 |
| InChI | InChI=1S/C14H14N4O3/c19-12(8-15-10-4-5-13(20)17-14(10)21)9-7-16-18-6-2-1-3-11(9)18/h1-3,6-7,10,15H,4-5,8H2,(H,17,20,21)/t10-/m0/s1 |
| InChIKey | TWWGPTLUULGYLP-JTQLQIEISA-N |
| XLogP | -0.09 |
| TPSA | 92.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|