C23H30O8 — CID 154967539
[(1R,2S,6R,10S,13S,14R)-13-acetyloxy-1,6,14-trihydroxy-4,12,12-trimethyl-5-oxo-8-tetracyclo[8.5.0.02,6.011,13]pentadeca-3,8-dienyl]methyl acetate (PubChem CID 154967539) has the molecular formula C23H30O8 and a molecular weight of 434.49 g/mol. Its IUPAC name is [(1R,2S,6R,10S,13S,14R)-13-acetyloxy-1,6,14-trihydroxy-4,12,12-trimethyl-5-oxo-8-tetracyclo[8.5.0.02,6.011,13]pentadeca-3,8-dienyl]methyl acetate.
| Compound Name | [(1R,2S,6R,10S,13S,14R)-13-acetyloxy-1,6,14-trihydroxy-4,12,12-trimethyl-5-oxo-8-tetracyclo[8.5.0.02,6.011,13]pentadeca-3,8-dienyl]methyl acetate |
|---|---|
| PubChem CID | 154967539 |
| Molecular Formula | C23H30O8 |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 434.19 |
| IUPAC Name | [(1R,2S,6R,10S,13S,14R)-13-acetyloxy-1,6,14-trihydroxy-4,12,12-trimethyl-5-oxo-8-tetracyclo[8.5.0.02,6.011,13]pentadeca-3,8-dienyl]methyl acetate |
| SMILES | CC(=O)OCC1=C[C@H]2C3C(C)(C)[C@]3(OC(C)=O)[C@H](O)C[C@]2(O)[C@@H]2C=C(C)C(=O)[C@@]2(O)C1 |
| InChI | InChI=1S/C23H30O8/c1-11-6-16-21(28)9-17(26)23(31-13(3)25)18(20(23,4)5)15(21)7-14(10-30-12(2)24)8-22(16,29)19(11)27/h6-7,15-18,26,28-29H,8-10H2,1-5H3/t15-,16-,17+,18?,21+,22+,23-/m0/s1 |
| InChIKey | DNXWESMUIHIFFR-VFQTXSMYSA-N |
| XLogP | 0.83 |
| TPSA | 130.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|