About N'-ethyl-N-[(3E)-hexa-3,5-dien-3-yl]methanimidamide
N'-ethyl-N-[(3E)-hexa-3,5-dien-3-yl]methanimidamide (PubChem CID 154967938) has the molecular formula C9H16N2
and a molecular weight of 152.24 g/mol. Its IUPAC name is N'-ethyl-N-[(3E)-hexa-3,5-dien-3-yl]methanimidamide.
Molecular Properties
| Compound Name | N'-ethyl-N-[(3E)-hexa-3,5-dien-3-yl]methanimidamide |
| PubChem CID | 154967938 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | N'-ethyl-N-[(3E)-hexa-3,5-dien-3-yl]methanimidamide |
| SMILES | C=C/C=C(\CC)N/C=N/CC |
| InChI | InChI=1S/C9H16N2/c1-4-7-9(5-2)11-8-10-6-3/h4,7-8H,1,5-6H2,2-3H3,(H,10,11)/b9-7+ |
| InChIKey | XYHZAXZCRMDAPS-VQHVLOKHSA-N |
| XLogP | 2.10 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N'-ethyl-N-[(3E)-hexa-3,5-dien-3-yl]methanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-ethyl-N-[(3E)-hexa-3,5-dien-3-yl]methanimidamide?
The IUPAC name of N'-ethyl-N-[(3E)-hexa-3,5-dien-3-yl]methanimidamide (CID 154967938) is N'-ethyl-N-[(3E)-hexa-3,5-dien-3-yl]methanimidamide.
What is the SMILES notation for N'-ethyl-N-[(3E)-hexa-3,5-dien-3-yl]methanimidamide?
The canonical SMILES for N'-ethyl-N-[(3E)-hexa-3,5-dien-3-yl]methanimidamide is C=C/C=C(\CC)N/C=N/CC.
What is the InChIKey of N'-ethyl-N-[(3E)-hexa-3,5-dien-3-yl]methanimidamide?
The InChIKey is XYHZAXZCRMDAPS-VQHVLOKHSA-N. The full InChI is InChI=1S/C9H16N2/c1-4-7-9(5-2)11-8-10-6-3/h4,7-8H,1,5-6H2,2-3H3,(H,10,11)/b9-7+.
What are the key properties of N'-ethyl-N-[(3E)-hexa-3,5-dien-3-yl]methanimidamide?
N'-ethyl-N-[(3E)-hexa-3,5-dien-3-yl]methanimidamide has a molecular weight of 152.24 g/mol, XLogP of 2.10, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N'-ethyl-N-[(3E)-hexa-3,5-dien-3-yl]methanimidamide is sourced from PubChem (CID 154967938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).