C20H22F2N4O — CID 154968176
[4-fluoro-2-[4-[(3R)-3-fluoropiperidin-3-yl]phenyl]indazol-7-yl]methoxymethanamine (PubChem CID 154968176) has the molecular formula C20H22F2N4O and a molecular weight of 372.42 g/mol. Its IUPAC name is [4-fluoro-2-[4-[(3R)-3-fluoropiperidin-3-yl]phenyl]indazol-7-yl]methoxymethanamine.
| Compound Name | [4-fluoro-2-[4-[(3R)-3-fluoropiperidin-3-yl]phenyl]indazol-7-yl]methoxymethanamine |
|---|---|
| PubChem CID | 154968176 |
| Molecular Formula | C20H22F2N4O |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | [4-fluoro-2-[4-[(3R)-3-fluoropiperidin-3-yl]phenyl]indazol-7-yl]methoxymethanamine |
| SMILES | NCOCc1ccc(F)c2cn(-c3ccc([C@]4(F)CCCNC4)cc3)nc12 |
| InChI | InChI=1S/C20H22F2N4O/c21-18-7-2-14(11-27-13-23)19-17(18)10-26(25-19)16-5-3-15(4-6-16)20(22)8-1-9-24-12-20/h2-7,10,24H,1,8-9,11-13,23H2/t20-/m0/s1 |
| InChIKey | FISLXMITORNIAY-FQEVSTJZSA-N |
| XLogP | 3.15 |
| TPSA | 65.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|