C20H24N2O2 — CID 15496843
(1S,5R,7R)-4-[(E)-but-2-enoyl]-10,10-dimethyl-3-phenyl-3,4-diazatricyclo[5.2.1.01,5]decan-2-one (PubChem CID 15496843) has the molecular formula C20H24N2O2 and a molecular weight of 324.42 g/mol. Its IUPAC name is (1S,5R,7R)-4-[(E)-but-2-enoyl]-10,10-dimethyl-3-phenyl-3,4-diazatricyclo[5.2.1.01,5]decan-2-one.
| Compound Name | (1S,5R,7R)-4-[(E)-but-2-enoyl]-10,10-dimethyl-3-phenyl-3,4-diazatricyclo[5.2.1.01,5]decan-2-one |
|---|---|
| PubChem CID | 15496843 |
| Molecular Formula | C20H24N2O2 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | (1S,5R,7R)-4-[(E)-but-2-enoyl]-10,10-dimethyl-3-phenyl-3,4-diazatricyclo[5.2.1.01,5]decan-2-one |
| SMILES | C/C=C/C(=O)N1[C@@H]2C[C@H]3CC[C@]2(C(=O)N1c1ccccc1)C3(C)C |
| InChI | InChI=1S/C20H24N2O2/c1-4-8-17(23)22-16-13-14-11-12-20(16,19(14,2)3)18(24)21(22)15-9-6-5-7-10-15/h4-10,14,16H,11-13H2,1-3H3/b8-4+/t14-,16-,20+/m1/s1 |
| InChIKey | IDSNVVNQEODWHL-SZGMFRDWSA-N |
| XLogP | 3.55 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|