C24H32N2O4S — CID 15496845
methyl 2-[(3S)-1-[(1S,5R,7R)-10,10-dimethyl-2-oxo-3-phenyl-3,4-diazatricyclo[5.2.1.01,5]decan-4-yl]-1-oxopentan-3-yl]sulfanylacetate (PubChem CID 15496845) has the molecular formula C24H32N2O4S and a molecular weight of 444.60 g/mol. Its IUPAC name is methyl 2-[(3S)-1-[(1S,5R,7R)-10,10-dimethyl-2-oxo-3-phenyl-3,4-diazatricyclo[5.2.1.01,5]decan-4-yl]-1-oxopentan-3-yl]sulfanylacetate.
| Compound Name | methyl 2-[(3S)-1-[(1S,5R,7R)-10,10-dimethyl-2-oxo-3-phenyl-3,4-diazatricyclo[5.2.1.01,5]decan-4-yl]-1-oxopentan-3-yl]sulfanylacetate |
|---|---|
| PubChem CID | 15496845 |
| Molecular Formula | C24H32N2O4S |
| Molecular Weight | 444.60 g/mol |
| Exact Mass | 444.21 |
| IUPAC Name | methyl 2-[(3S)-1-[(1S,5R,7R)-10,10-dimethyl-2-oxo-3-phenyl-3,4-diazatricyclo[5.2.1.01,5]decan-4-yl]-1-oxopentan-3-yl]sulfanylacetate |
| SMILES | CC[C@@H](CC(=O)N1[C@@H]2C[C@H]3CC[C@]2(C(=O)N1c1ccccc1)C3(C)C)SCC(=O)OC |
| InChI | InChI=1S/C24H32N2O4S/c1-5-18(31-15-21(28)30-4)14-20(27)26-19-13-16-11-12-24(19,23(16,2)3)22(29)25(26)17-9-7-6-8-10-17/h6-10,16,18-19H,5,11-15H2,1-4H3/t16-,18+,19-,24+/m1/s1 |
| InChIKey | CLDUUDDUNCSXDZ-YRHGQSLTSA-N |
| XLogP | 4.05 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.60 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |