C20H18O3 — CID 154968471
3,6,9-trimethyl-5-phenyl-7H-furo[3,2-g]chromen-7-ol (PubChem CID 154968471) has the molecular formula C20H18O3 and a molecular weight of 306.36 g/mol. Its IUPAC name is 3,6,9-trimethyl-5-phenyl-7H-furo[3,2-g]chromen-7-ol.
| Compound Name | 3,6,9-trimethyl-5-phenyl-7H-furo[3,2-g]chromen-7-ol |
|---|---|
| PubChem CID | 154968471 |
| Molecular Formula | C20H18O3 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | 3,6,9-trimethyl-5-phenyl-7H-furo[3,2-g]chromen-7-ol |
| SMILES | CC1=C(c2ccccc2)c2cc3c(C)coc3c(C)c2OC1O |
| InChI | InChI=1S/C20H18O3/c1-11-10-22-18-13(3)19-16(9-15(11)18)17(12(2)20(21)23-19)14-7-5-4-6-8-14/h4-10,20-21H,1-3H3 |
| InChIKey | BEURHXVXMUTBOW-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 42.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |