About 2-[(3S)-3-(dimethylamino)pyrrolidin-1-yl]-N'-ethenylpropanimidamide
2-[(3S)-3-(dimethylamino)pyrrolidin-1-yl]-N'-ethenylpropanimidamide (PubChem CID 154969069) has the molecular formula C11H22N4
and a molecular weight of 210.32 g/mol. Its IUPAC name is 2-[(3S)-3-(dimethylamino)pyrrolidin-1-yl]-N'-ethenylpropanimidamide.
Molecular Properties
| Compound Name | 2-[(3S)-3-(dimethylamino)pyrrolidin-1-yl]-N'-ethenylpropanimidamide |
| PubChem CID | 154969069 |
| Molecular Formula | C11H22N4 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.18 |
| IUPAC Name | 2-[(3S)-3-(dimethylamino)pyrrolidin-1-yl]-N'-ethenylpropanimidamide |
| SMILES | C=C/N=C(\N)C(C)N1CC[C@H](N(C)C)C1 |
| InChI | InChI=1S/C11H22N4/c1-5-13-11(12)9(2)15-7-6-10(8-15)14(3)4/h5,9-10H,1,6-8H2,2-4H3,(H2,12,13)/t9?,10-/m0/s1 |
| InChIKey | SHYNIBRWAIORTH-AXDSSHIGSA-N |
| XLogP | 0.51 |
| TPSA | 44.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[(3S)-3-(dimethylamino)pyrrolidin-1-yl]-N'-ethenylpropanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3S)-3-(dimethylamino)pyrrolidin-1-yl]-N'-ethenylpropanimidamide?
The IUPAC name of 2-[(3S)-3-(dimethylamino)pyrrolidin-1-yl]-N'-ethenylpropanimidamide (CID 154969069) is 2-[(3S)-3-(dimethylamino)pyrrolidin-1-yl]-N'-ethenylpropanimidamide.
What is the SMILES notation for 2-[(3S)-3-(dimethylamino)pyrrolidin-1-yl]-N'-ethenylpropanimidamide?
The canonical SMILES for 2-[(3S)-3-(dimethylamino)pyrrolidin-1-yl]-N'-ethenylpropanimidamide is C=C/N=C(\N)C(C)N1CC[C@H](N(C)C)C1.
What is the InChIKey of 2-[(3S)-3-(dimethylamino)pyrrolidin-1-yl]-N'-ethenylpropanimidamide?
The InChIKey is SHYNIBRWAIORTH-AXDSSHIGSA-N. The full InChI is InChI=1S/C11H22N4/c1-5-13-11(12)9(2)15-7-6-10(8-15)14(3)4/h5,9-10H,1,6-8H2,2-4H3,(H2,12,13)/t9?,10-/m0/s1.
What are the key properties of 2-[(3S)-3-(dimethylamino)pyrrolidin-1-yl]-N'-ethenylpropanimidamide?
2-[(3S)-3-(dimethylamino)pyrrolidin-1-yl]-N'-ethenylpropanimidamide has a molecular weight of 210.32 g/mol, XLogP of 0.51, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3S)-3-(dimethylamino)pyrrolidin-1-yl]-N'-ethenylpropanimidamide is sourced from PubChem (CID 154969069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).