C16H23NO3 — CID 154969242
[(E)-[1-(3,6-dimethylcyclohexa-1,5-dien-1-yl)-2,4-dimethyl-3-oxopentylidene]amino] formate (PubChem CID 154969242) has the molecular formula C16H23NO3 and a molecular weight of 277.36 g/mol. Its IUPAC name is [(E)-[1-(3,6-dimethylcyclohexa-1,5-dien-1-yl)-2,4-dimethyl-3-oxopentylidene]amino] formate.
| Compound Name | [(E)-[1-(3,6-dimethylcyclohexa-1,5-dien-1-yl)-2,4-dimethyl-3-oxopentylidene]amino] formate |
|---|---|
| PubChem CID | 154969242 |
| Molecular Formula | C16H23NO3 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | [(E)-[1-(3,6-dimethylcyclohexa-1,5-dien-1-yl)-2,4-dimethyl-3-oxopentylidene]amino] formate |
| SMILES | CC1=CCC(C)C=C1/C(=N/OC=O)C(C)C(=O)C(C)C |
| InChI | InChI=1S/C16H23NO3/c1-10(2)16(19)13(5)15(17-20-9-18)14-8-11(3)6-7-12(14)4/h7-11,13H,6H2,1-5H3/b17-15+ |
| InChIKey | WEQRHHSJTJEFNK-BMRADRMJSA-N |
| XLogP | 3.29 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|