C54H41F3N2O3S — CID 154969268
[3-[2-(4,6-diphenyl-3-pyridinyl)phenyl]-5-[2-[4-[5-[(2E,4Z)-hexa-2,4-dien-2-yl]-4-methyl-2-pyridinyl]phenyl]phenyl]phenyl] trifluoromethanesulfonate (PubChem CID 154969268) has the molecular formula C54H41F3N2O3S and a molecular weight of 854.99 g/mol. Its IUPAC name is [3-[2-(4,6-diphenyl-3-pyridinyl)phenyl]-5-[2-[4-[5-[(2E,4Z)-hexa-2,4-dien-2-yl]-4-methyl-2-pyridinyl]phenyl]phenyl]phenyl] trifluoromethanesulfonate.
| Compound Name | [3-[2-(4,6-diphenyl-3-pyridinyl)phenyl]-5-[2-[4-[5-[(2E,4Z)-hexa-2,4-dien-2-yl]-4-methyl-2-pyridinyl]phenyl]phenyl]phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 154969268 |
| Molecular Formula | C54H41F3N2O3S |
| Molecular Weight | 854.99 g/mol |
| Exact Mass | 854.28 |
| IUPAC Name | [3-[2-(4,6-diphenyl-3-pyridinyl)phenyl]-5-[2-[4-[5-[(2E,4Z)-hexa-2,4-dien-2-yl]-4-methyl-2-pyridinyl]phenyl]phenyl]phenyl] trifluoromethanesulfonate |
| SMILES | C/C=C\C=C(/C)c1cnc(-c2ccc(-c3ccccc3-c3cc(OS(=O)(=O)C(F)(F)F)cc(-c4ccccc4-c4cnc(-c5ccccc5)cc4-c4ccccc4)c3)cc2)cc1C |
| InChI | InChI=1S/C54H41F3N2O3S/c1-4-5-16-36(2)50-34-58-52(29-37(50)3)41-27-25-39(26-28-41)45-21-12-13-22-46(45)42-30-43(32-44(31-42)62-63(60,61)54(55,56)57)47-23-14-15-24-48(47)51-35-59-53(40-19-10-7-11-20-40)33-49(51)38-17-8-6-9-18-38/h4-35H,1-3H3/b5-4-,36-16+ |
| InChIKey | VWIFRCLBHMQLMQ-WNJUZOTLSA-N |
| XLogP | 14.66 |
| TPSA | 69.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 854.99 |
| LogP ≤ 5 | 14.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|