C32H47N5 — CID 154969646
(16E,20E)-5-ethyl-N,15,16,18,20-pentamethyl-2,11-dimethylidene-1,12,15,19-tetrazatricyclo[21.4.0.03,8]heptacosa-3(8),4,6,16,18,20-hexaen-22-imine (PubChem CID 154969646) has the molecular formula C32H47N5 and a molecular weight of 501.76 g/mol. Its IUPAC name is (16E,20E)-5-ethyl-N,15,16,18,20-pentamethyl-2,11-dimethylidene-1,12,15,19-tetrazatricyclo[21.4.0.03,8]heptacosa-3(8),4,6,16,18,20-hexaen-22-imine.
| Compound Name | (16E,20E)-5-ethyl-N,15,16,18,20-pentamethyl-2,11-dimethylidene-1,12,15,19-tetrazatricyclo[21.4.0.03,8]heptacosa-3(8),4,6,16,18,20-hexaen-22-imine |
|---|---|
| PubChem CID | 154969646 |
| Molecular Formula | C32H47N5 |
| Molecular Weight | 501.76 g/mol |
| Exact Mass | 501.38 |
| IUPAC Name | (16E,20E)-5-ethyl-N,15,16,18,20-pentamethyl-2,11-dimethylidene-1,12,15,19-tetrazatricyclo[21.4.0.03,8]heptacosa-3(8),4,6,16,18,20-hexaen-22-imine |
| SMILES | C=C1CCc2ccc(CC)cc2C(=C)N2CCCCC2C(=N/C)/C=C(C)/N=C(C)\C=C(/C)N(C)CCN1 |
| InChI | InChI=1S/C32H47N5/c1-9-28-14-16-29-15-13-23(2)34-17-19-36(8)26(5)20-24(3)35-25(4)21-31(33-7)32-12-10-11-18-37(32)27(6)30(29)22-28/h14,16,20-22,32,34H,2,6,9-13,15,17-19H2,1,3-5,7-8H3/b25-21+,26-20+,33-31+,35-24- |
| InChIKey | MZTYDRQMZQRQPB-IGJYDNRISA-N |
| XLogP | 6.39 |
| TPSA | 43.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.76 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|